C27H35NO3 — CID 135033433
tert-butyl (1S,6R,7R)-7-[benzyl-[(1S)-1-phenylethyl]amino]-6-hydroxycyclohept-3-ene-1-carboxylate (PubChem CID 135033433) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is tert-butyl (1S,6R,7R)-7-[benzyl-[(1S)-1-phenylethyl]amino]-6-hydroxycyclohept-3-ene-1-carboxylate.
| Compound Name | tert-butyl (1S,6R,7R)-7-[benzyl-[(1S)-1-phenylethyl]amino]-6-hydroxycyclohept-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 135033433 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | tert-butyl (1S,6R,7R)-7-[benzyl-[(1S)-1-phenylethyl]amino]-6-hydroxycyclohept-3-ene-1-carboxylate |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@H]1[C@H](O)CC=CC[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H35NO3/c1-20(22-15-9-6-10-16-22)28(19-21-13-7-5-8-14-21)25-23(17-11-12-18-24(25)29)26(30)31-27(2,3)4/h5-16,20,23-25,29H,17-19H2,1-4H3/t20-,23-,24+,25+/m0/s1 |
| InChIKey | BBQADEOPKHRURV-MNPDLOSFSA-N |
| XLogP | 5.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|