C29H35NO3 — CID 10599465
tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-phenylpentanoate (PubChem CID 10599465) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-phenylpentanoate.
| Compound Name | tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-phenylpentanoate |
|---|---|
| PubChem CID | 10599465 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | tert-butyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-phenylpentanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H35NO3/c1-29(2,3)33-28(32)20-27(31)26(19-23-13-7-4-8-14-23)30(21-24-15-9-5-10-16-24)22-25-17-11-6-12-18-25/h4-18,26-27,31H,19-22H2,1-3H3/t26-,27-/m0/s1 |
| InChIKey | CKCLEKWBLCIDRC-SVBPBHIXSA-N |
| XLogP | 5.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |