C35H53NO3Si — CID 135033432
tert-butyl (2S,3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-prop-2-enyl-4-triethylsilyloxyhept-6-enoate (PubChem CID 135033432) has the molecular formula C35H53NO3Si and a molecular weight of 563.90 g/mol. Its IUPAC name is tert-butyl (2S,3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-prop-2-enyl-4-triethylsilyloxyhept-6-enoate.
| Compound Name | tert-butyl (2S,3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-prop-2-enyl-4-triethylsilyloxyhept-6-enoate |
|---|---|
| PubChem CID | 135033432 |
| Molecular Formula | C35H53NO3Si |
| Molecular Weight | 563.90 g/mol |
| Exact Mass | 563.38 |
| IUPAC Name | tert-butyl (2S,3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-prop-2-enyl-4-triethylsilyloxyhept-6-enoate |
| SMILES | C=CC[C@H](C(=O)OC(C)(C)C)[C@H]([C@@H](CC=C)O[Si](CC)(CC)CC)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C35H53NO3Si/c1-10-21-31(34(37)38-35(7,8)9)33(32(22-11-2)39-40(12-3,13-4)14-5)36(27-29-23-17-15-18-24-29)28(6)30-25-19-16-20-26-30/h10-11,15-20,23-26,28,31-33H,1-2,12-14,21-22,27H2,3-9H3/t28-,31-,32+,33+/m0/s1 |
| InChIKey | MOVQKPZZSHLSKB-OYUXKOKYSA-N |
| XLogP | 9.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.90 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|