C29H39NO3 — CID 135032594
tert-butyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-[(1S)-1-hydroxyprop-2-enyl]hept-6-enoate (PubChem CID 135032594) has the molecular formula C29H39NO3 and a molecular weight of 449.64 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-[(1S)-1-hydroxyprop-2-enyl]hept-6-enoate.
| Compound Name | tert-butyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-[(1S)-1-hydroxyprop-2-enyl]hept-6-enoate |
|---|---|
| PubChem CID | 135032594 |
| Molecular Formula | C29H39NO3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | tert-butyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-[(1S)-1-hydroxyprop-2-enyl]hept-6-enoate |
| SMILES | C=CCC[C@@H]([C@H](C(=O)OC(C)(C)C)[C@@H](O)C=C)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C29H39NO3/c1-7-9-20-25(27(26(31)8-2)28(32)33-29(4,5)6)30(21-23-16-12-10-13-17-23)22(3)24-18-14-11-15-19-24/h7-8,10-19,22,25-27,31H,1-2,9,20-21H2,3-6H3/t22-,25-,26-,27-/m0/s1 |
| InChIKey | BJUISQVKRLIPTN-OXCFDMGDSA-N |
| XLogP | 6.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|