C21H25NO3 — CID 11221468
(3R)-3-[(1R,2S)-2-(dibenzylamino)-1-hydroxypropyl]oxolan-2-one (PubChem CID 11221468) has the molecular formula C21H25NO3 and a molecular weight of 339.43 g/mol. Its IUPAC name is (3R)-3-[(1R,2S)-2-(dibenzylamino)-1-hydroxypropyl]oxolan-2-one.
| Compound Name | (3R)-3-[(1R,2S)-2-(dibenzylamino)-1-hydroxypropyl]oxolan-2-one |
|---|---|
| PubChem CID | 11221468 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (3R)-3-[(1R,2S)-2-(dibenzylamino)-1-hydroxypropyl]oxolan-2-one |
| SMILES | C[C@@H]([C@H](O)[C@H]1CCOC1=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-16(20(23)19-12-13-25-21(19)24)22(14-17-8-4-2-5-9-17)15-18-10-6-3-7-11-18/h2-11,16,19-20,23H,12-15H2,1H3/t16-,19+,20-/m0/s1 |
| InChIKey | NHPDXDLVIMCMPX-DBVUQKKJSA-N |
| XLogP | 3.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |