C24H31NO3 — CID 11280484
(3R)-3-[(1S,2S)-2-(dibenzylamino)-1-hydroxy-4-methylpentyl]oxolan-2-one (PubChem CID 11280484) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (3R)-3-[(1S,2S)-2-(dibenzylamino)-1-hydroxy-4-methylpentyl]oxolan-2-one.
| Compound Name | (3R)-3-[(1S,2S)-2-(dibenzylamino)-1-hydroxy-4-methylpentyl]oxolan-2-one |
|---|---|
| PubChem CID | 11280484 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (3R)-3-[(1S,2S)-2-(dibenzylamino)-1-hydroxy-4-methylpentyl]oxolan-2-one |
| SMILES | CC(C)C[C@@H]([C@@H](O)[C@H]1CCOC1=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H31NO3/c1-18(2)15-22(23(26)21-13-14-28-24(21)27)25(16-19-9-5-3-6-10-19)17-20-11-7-4-8-12-20/h3-12,18,21-23,26H,13-17H2,1-2H3/t21-,22+,23+/m1/s1 |
| InChIKey | PWUXYSCBCPKXPR-VJBWXMMDSA-N |
| XLogP | 4.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |