C48H62N2O6 — CID 139089453
(3S)-3-[(1R,2S)-2-(dibenzylamino)-1-hydroxy-4-methylpentyl]oxolan-2-one (PubChem CID 139089453) has the molecular formula C48H62N2O6 and a molecular weight of 763.03 g/mol. Its IUPAC name is (3S)-3-[(1R,2S)-2-(dibenzylamino)-1-hydroxy-4-methylpentyl]oxolan-2-one.
| Compound Name | (3S)-3-[(1R,2S)-2-(dibenzylamino)-1-hydroxy-4-methylpentyl]oxolan-2-one |
|---|---|
| PubChem CID | 139089453 |
| Molecular Formula | C48H62N2O6 |
| Molecular Weight | 763.03 g/mol |
| Exact Mass | 762.46 |
| IUPAC Name | (3S)-3-[(1R,2S)-2-(dibenzylamino)-1-hydroxy-4-methylpentyl]oxolan-2-one |
| SMILES | CC(C)C[C@@H]([C@H](O)[C@@H]1CCOC1=O)N(Cc1ccccc1)Cc1ccccc1.CC(C)C[C@@H]([C@H](O)[C@@H]1CCOC1=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/2C24H31NO3/c2*1-18(2)15-22(23(26)21-13-14-28-24(21)27)25(16-19-9-5-3-6-10-19)17-20-11-7-4-8-12-20/h2*3-12,18,21-23,26H,13-17H2,1-2H3/t2*21-,22-,23+/m00/s1 |
| InChIKey | AYSYIJBOEONZCD-UCAIGWATSA-N |
| XLogP | 8.06 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.03 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |