C34H49NO3Si2 — CID 101021867
(3R,4S,5S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-phenylethynyl)-5-prop-2-enylpyrrolidin-2-one (PubChem CID 101021867) has the molecular formula C34H49NO3Si2 and a molecular weight of 575.94 g/mol. Its IUPAC name is (3R,4S,5S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-phenylethynyl)-5-prop-2-enylpyrrolidin-2-one.
| Compound Name | (3R,4S,5S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-phenylethynyl)-5-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 101021867 |
| Molecular Formula | C34H49NO3Si2 |
| Molecular Weight | 575.94 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | (3R,4S,5S)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2-phenylethynyl)-5-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CC[C@]1(C#Cc2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C34H49NO3Si2/c1-12-24-34(25-23-27-19-15-13-16-20-27)30(38-40(10,11)33(5,6)7)29(37-39(8,9)32(2,3)4)31(36)35(34)26-28-21-17-14-18-22-28/h12-22,29-30H,1,24,26H2,2-11H3/t29-,30-,34+/m1/s1 |
| InChIKey | XDNXVTRWKGWPTL-RWSVXVLSSA-N |
| XLogP | 8.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.94 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|