C47H85NO3Si3 — CID 134863632
(E,2S,3S,4R)-N,N-dibenzyl-1,3,4-tris[[tert-butyl(dimethyl)silyl]oxy]pentadec-5-en-2-amine (PubChem CID 134863632) has the molecular formula C47H85NO3Si3 and a molecular weight of 796.46 g/mol. Its IUPAC name is (E,2S,3S,4R)-N,N-dibenzyl-1,3,4-tris[[tert-butyl(dimethyl)silyl]oxy]pentadec-5-en-2-amine.
| Compound Name | (E,2S,3S,4R)-N,N-dibenzyl-1,3,4-tris[[tert-butyl(dimethyl)silyl]oxy]pentadec-5-en-2-amine |
|---|---|
| PubChem CID | 134863632 |
| Molecular Formula | C47H85NO3Si3 |
| Molecular Weight | 796.46 g/mol |
| Exact Mass | 795.58 |
| IUPAC Name | (E,2S,3S,4R)-N,N-dibenzyl-1,3,4-tris[[tert-butyl(dimethyl)silyl]oxy]pentadec-5-en-2-amine |
| SMILES | CCCCCCCCC/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C47H85NO3Si3/c1-17-18-19-20-21-22-23-24-31-36-43(50-53(13,14)46(5,6)7)44(51-54(15,16)47(8,9)10)42(39-49-52(11,12)45(2,3)4)48(37-40-32-27-25-28-33-40)38-41-34-29-26-30-35-41/h25-36,42-44H,17-24,37-39H2,1-16H3/b36-31+/t42-,43+,44-/m0/s1 |
| InChIKey | OSCCFIQFOXOEPB-KZYDRAJSSA-N |
| XLogP | 14.56 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.46 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|