C24H37NOSi — CID 134850969
(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-N-methyl-1-phenyl-N-(2-phenylethyl)propan-2-amine (PubChem CID 134850969) has the molecular formula C24H37NOSi and a molecular weight of 383.65 g/mol. Its IUPAC name is (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-N-methyl-1-phenyl-N-(2-phenylethyl)propan-2-amine.
| Compound Name | (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-N-methyl-1-phenyl-N-(2-phenylethyl)propan-2-amine |
|---|---|
| PubChem CID | 134850969 |
| Molecular Formula | C24H37NOSi |
| Molecular Weight | 383.65 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-N-methyl-1-phenyl-N-(2-phenylethyl)propan-2-amine |
| SMILES | C[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1)N(C)CCc1ccccc1 |
| InChI | InChI=1S/C24H37NOSi/c1-20(25(5)19-18-21-14-10-8-11-15-21)23(22-16-12-9-13-17-22)26-27(6,7)24(2,3)4/h8-17,20,23H,18-19H2,1-7H3/t20-,23-/m1/s1 |
| InChIKey | CAKJUDKIHYEVMM-NFBKMPQASA-N |
| XLogP | 6.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|