C20H33NOSi — CID 53344024
tert-butyl-dimethyl-[(E,1R)-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]but-2-enoxy]silane (PubChem CID 53344024) has the molecular formula C20H33NOSi and a molecular weight of 331.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,1R)-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]but-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E,1R)-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]but-2-enoxy]silane |
|---|---|
| PubChem CID | 53344024 |
| Molecular Formula | C20H33NOSi |
| Molecular Weight | 331.58 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | tert-butyl-dimethyl-[(E,1R)-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]but-2-enoxy]silane |
| SMILES | C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CN1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H33NOSi/c1-8-12-19(22-23(6,7)20(3,4)5)18-15-21(18)16(2)17-13-10-9-11-14-17/h8-14,16,18-19H,15H2,1-7H3/b12-8+/t16-,18+,19-,21?/m1/s1 |
| InChIKey | OZMNXMGHDBKCEM-MEFKOXFHSA-N |
| XLogP | 5.40 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|