C22H31NOSi — CID 102014997
[(2S,3R)-1-benzyl-3-phenylaziridin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 102014997) has the molecular formula C22H31NOSi and a molecular weight of 353.58 g/mol. Its IUPAC name is [(2S,3R)-1-benzyl-3-phenylaziridin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R)-1-benzyl-3-phenylaziridin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102014997 |
| Molecular Formula | C22H31NOSi |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | [(2S,3R)-1-benzyl-3-phenylaziridin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H31NOSi/c1-22(2,3)25(4,5)24-17-20-21(19-14-10-7-11-15-19)23(20)16-18-12-8-6-9-13-18/h6-15,20-21H,16-17H2,1-5H3/t20-,21-,23?/m1/s1 |
| InChIKey | IMSCUHZDFCUXRR-OJOWTSHBSA-N |
| XLogP | 5.63 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|