C20H32F3NOSi — CID 91317259
tert-butyl-[[(2R,3R)-1-tert-butyl-3-[4-(trifluoromethyl)phenyl]aziridin-2-yl]methoxy]-dimethylsilane (PubChem CID 91317259) has the molecular formula C20H32F3NOSi and a molecular weight of 387.56 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R)-1-tert-butyl-3-[4-(trifluoromethyl)phenyl]aziridin-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3R)-1-tert-butyl-3-[4-(trifluoromethyl)phenyl]aziridin-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 91317259 |
| Molecular Formula | C20H32F3NOSi |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl-[[(2R,3R)-1-tert-butyl-3-[4-(trifluoromethyl)phenyl]aziridin-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)N1[C@H](c2ccc(C(F)(F)F)cc2)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32F3NOSi/c1-18(2,3)24-16(13-25-26(7,8)19(4,5)6)17(24)14-9-11-15(12-10-14)20(21,22)23/h9-12,16-17H,13H2,1-8H3/t16-,17+,24?/m0/s1 |
| InChIKey | SEXZXBTUWPLBAP-HSQXHLSASA-N |
| XLogP | 6.25 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|