C21H32F3NO3Si — CID 88872150
tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[4-(trifluoromethyl)phenyl]aziridine-1-carboxylate (PubChem CID 88872150) has the molecular formula C21H32F3NO3Si and a molecular weight of 431.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[4-(trifluoromethyl)phenyl]aziridine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[4-(trifluoromethyl)phenyl]aziridine-1-carboxylate |
|---|---|
| PubChem CID | 88872150 |
| Molecular Formula | C21H32F3NO3Si |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | tert-butyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[4-(trifluoromethyl)phenyl]aziridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(c2ccc(C(F)(F)F)cc2)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32F3NO3Si/c1-19(2,3)28-18(26)25-16(13-27-29(7,8)20(4,5)6)17(25)14-9-11-15(12-10-14)21(22,23)24/h9-12,16-17H,13H2,1-8H3/t16-,17?,25?/m1/s1 |
| InChIKey | FESHEJBQUYDIRX-DSYAXSJVSA-N |
| XLogP | 6.39 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|