C21H34FNO3Si — CID 66690050
tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-fluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 66690050) has the molecular formula C21H34FNO3Si and a molecular weight of 395.59 g/mol. Its IUPAC name is tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-fluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-fluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66690050 |
| Molecular Formula | C21H34FNO3Si |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(3-fluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](O[Si](C)(C)C(C)(C)C)C1c1cccc(F)c1 |
| InChI | InChI=1S/C21H34FNO3Si/c1-20(2,3)25-19(24)23-13-12-17(26-27(7,8)21(4,5)6)18(23)15-10-9-11-16(22)14-15/h9-11,14,17-18H,12-13H2,1-8H3/t17-,18?/m0/s1 |
| InChIKey | KDLODJLNXYAPBQ-ZENAZSQFSA-N |
| XLogP | 5.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|