C10H9F2NO2 — CID 10198244
(4S)-4-(3,4-difluorophenyl)-3-methyl-1,3-oxazolidin-2-one (PubChem CID 10198244) has the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. Its IUPAC name is (4S)-4-(3,4-difluorophenyl)-3-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(3,4-difluorophenyl)-3-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10198244 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (4S)-4-(3,4-difluorophenyl)-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1C(=O)OC[C@@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H9F2NO2/c1-13-9(5-15-10(13)14)6-2-3-7(11)8(12)4-6/h2-4,9H,5H2,1H3/t9-/m1/s1 |
| InChIKey | OHWFCDYDBQUUQR-SECBINFHSA-N |
| XLogP | 2.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |