C28H39NOSi — CID 102324961
[(2R,4R,6S)-1-benzyl-2-ethenyl-6-[(E)-2-phenylethenyl]piperidin-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102324961) has the molecular formula C28H39NOSi and a molecular weight of 433.71 g/mol. Its IUPAC name is [(2R,4R,6S)-1-benzyl-2-ethenyl-6-[(E)-2-phenylethenyl]piperidin-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4R,6S)-1-benzyl-2-ethenyl-6-[(E)-2-phenylethenyl]piperidin-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102324961 |
| Molecular Formula | C28H39NOSi |
| Molecular Weight | 433.71 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | [(2R,4R,6S)-1-benzyl-2-ethenyl-6-[(E)-2-phenylethenyl]piperidin-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](/C=C/c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H39NOSi/c1-7-25-20-27(30-31(5,6)28(2,3)4)21-26(19-18-23-14-10-8-11-15-23)29(25)22-24-16-12-9-13-17-24/h7-19,25-27H,1,20-22H2,2-6H3/b19-18+/t25-,26+,27+/m0/s1 |
| InChIKey | VCFNSLZGTKBODB-KDGSMCSDSA-N |
| XLogP | 7.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.71 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|