C21H34FNOSi — CID 141172688
[(2R,4S,9aR)-4-(4-fluorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 141172688) has the molecular formula C21H34FNOSi and a molecular weight of 363.59 g/mol. Its IUPAC name is [(2R,4S,9aR)-4-(4-fluorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4S,9aR)-4-(4-fluorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 141172688 |
| Molecular Formula | C21H34FNOSi |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | [(2R,4S,9aR)-4-(4-fluorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H]2CCCCN2[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H34FNOSi/c1-21(2,3)25(4,5)24-19-14-18-8-6-7-13-23(18)20(15-19)16-9-11-17(22)12-10-16/h9-12,18-20H,6-8,13-15H2,1-5H3/t18-,19-,20+/m1/s1 |
| InChIKey | HHOQWZDMZYIVFZ-AQNXPRMDSA-N |
| XLogP | 5.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|