C22H24FNO — CID 102324966
(2R,4R,6S)-1-benzyl-2-ethenyl-6-[(E)-2-(2-fluorophenyl)ethenyl]piperidin-4-ol (PubChem CID 102324966) has the molecular formula C22H24FNO and a molecular weight of 337.44 g/mol. Its IUPAC name is (2R,4R,6S)-1-benzyl-2-ethenyl-6-[(E)-2-(2-fluorophenyl)ethenyl]piperidin-4-ol.
| Compound Name | (2R,4R,6S)-1-benzyl-2-ethenyl-6-[(E)-2-(2-fluorophenyl)ethenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 102324966 |
| Molecular Formula | C22H24FNO |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (2R,4R,6S)-1-benzyl-2-ethenyl-6-[(E)-2-(2-fluorophenyl)ethenyl]piperidin-4-ol |
| SMILES | C=C[C@H]1C[C@@H](O)C[C@@H](/C=C/c2ccccc2F)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H24FNO/c1-2-19-14-21(25)15-20(13-12-18-10-6-7-11-22(18)23)24(19)16-17-8-4-3-5-9-17/h2-13,19-21,25H,1,14-16H2/b13-12+/t19-,20+,21+/m0/s1 |
| InChIKey | UGBSUZDKJSGDER-BDRHDCMESA-N |
| XLogP | 4.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|