C23H34F3NOSi — CID 135000053
tert-butyl-[(2R,4R,6S)-2-ethenyl-1-methyl-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]piperidin-4-yl]oxy-dimethylsilane (PubChem CID 135000053) has the molecular formula C23H34F3NOSi and a molecular weight of 425.61 g/mol. Its IUPAC name is tert-butyl-[(2R,4R,6S)-2-ethenyl-1-methyl-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]piperidin-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,4R,6S)-2-ethenyl-1-methyl-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]piperidin-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135000053 |
| Molecular Formula | C23H34F3NOSi |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | tert-butyl-[(2R,4R,6S)-2-ethenyl-1-methyl-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]piperidin-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](/C=C/c2ccc(C(F)(F)F)cc2)N1C |
| InChI | InChI=1S/C23H34F3NOSi/c1-8-19-15-21(28-29(6,7)22(2,3)4)16-20(27(19)5)14-11-17-9-12-18(13-10-17)23(24,25)26/h8-14,19-21H,1,15-16H2,2-7H3/b14-11+/t19-,20+,21+/m0/s1 |
| InChIKey | ZWQOOYWCBPNZCI-LLHFRWLPSA-N |
| XLogP | 6.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|