C32H53NO2Si — CID 56931429
(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)dodecan-3-ol (PubChem CID 56931429) has the molecular formula C32H53NO2Si and a molecular weight of 511.87 g/mol. Its IUPAC name is (2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)dodecan-3-ol.
| Compound Name | (2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)dodecan-3-ol |
|---|---|
| PubChem CID | 56931429 |
| Molecular Formula | C32H53NO2Si |
| Molecular Weight | 511.87 g/mol |
| Exact Mass | 511.38 |
| IUPAC Name | (2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)dodecan-3-ol |
| SMILES | CCCCCCCCC[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H53NO2Si/c1-7-8-9-10-11-12-19-24-31(34)30(27-35-36(5,6)32(2,3)4)33(25-28-20-15-13-16-21-28)26-29-22-17-14-18-23-29/h13-18,20-23,30-31,34H,7-12,19,24-27H2,1-6H3/t30-,31+/m1/s1 |
| InChIKey | RPBCDVFGRQJVSR-JSOSNVBQSA-N |
| XLogP | 8.58 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.87 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|