C22H31NO — CID 10782330
(3R,4S)-4-(dibenzylamino)-6-methylheptan-3-ol (PubChem CID 10782330) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is (3R,4S)-4-(dibenzylamino)-6-methylheptan-3-ol.
| Compound Name | (3R,4S)-4-(dibenzylamino)-6-methylheptan-3-ol |
|---|---|
| PubChem CID | 10782330 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | (3R,4S)-4-(dibenzylamino)-6-methylheptan-3-ol |
| SMILES | CC[C@@H](O)[C@H](CC(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H31NO/c1-4-22(24)21(15-18(2)3)23(16-19-11-7-5-8-12-19)17-20-13-9-6-10-14-20/h5-14,18,21-22,24H,4,15-17H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | SWHDEAWAFSGFPL-FCHUYYIVSA-N |
| XLogP | 4.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |