C29H55NO2Si2 — CID 56968562
tert-butyl-dimethyl-[(1R)-1-[(2S)-1-[(1S)-1-phenylethyl]aziridin-2-yl]-4-tri(propan-2-yl)silyloxybutoxy]silane (PubChem CID 56968562) has the molecular formula C29H55NO2Si2 and a molecular weight of 505.94 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-1-[(2S)-1-[(1S)-1-phenylethyl]aziridin-2-yl]-4-tri(propan-2-yl)silyloxybutoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1R)-1-[(2S)-1-[(1S)-1-phenylethyl]aziridin-2-yl]-4-tri(propan-2-yl)silyloxybutoxy]silane |
|---|---|
| PubChem CID | 56968562 |
| Molecular Formula | C29H55NO2Si2 |
| Molecular Weight | 505.94 g/mol |
| Exact Mass | 505.38 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-1-[(2S)-1-[(1S)-1-phenylethyl]aziridin-2-yl]-4-tri(propan-2-yl)silyloxybutoxy]silane |
| SMILES | CC(C)[Si](OCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CN1[C@@H](C)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H55NO2Si2/c1-22(2)34(23(3)4,24(5)6)31-20-16-19-28(32-33(11,12)29(8,9)10)27-21-30(27)25(7)26-17-14-13-15-18-26/h13-15,17-18,22-25,27-28H,16,19-21H2,1-12H3/t25-,27-,28+,30?/m0/s1 |
| InChIKey | RZGILXUOUWXPJL-AUSTWIBXSA-N |
| XLogP | 8.79 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.94 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|