C25H43NO4Si2 — CID 10390301
2-[(2R,3S,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidin-2-yl]acetaldehyde (PubChem CID 10390301) has the molecular formula C25H43NO4Si2 and a molecular weight of 477.79 g/mol. Its IUPAC name is 2-[(2R,3S,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidin-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,3S,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 10390301 |
| Molecular Formula | C25H43NO4Si2 |
| Molecular Weight | 477.79 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 2-[(2R,3S,4R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxopyrrolidin-2-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CC=O)N(Cc2ccccc2)C(=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H43NO4Si2/c1-24(2,3)31(7,8)29-21-20(16-17-27)26(18-19-14-12-11-13-15-19)23(28)22(21)30-32(9,10)25(4,5)6/h11-15,17,20-22H,16,18H2,1-10H3/t20-,21+,22-/m1/s1 |
| InChIKey | YHGLIEZVGBOWCL-BHIFYINESA-N |
| XLogP | 5.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.79 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|