C39H59NO7Si — CID 134852995
1-O-tert-butyl 2-O-methyl (2S,5S)-2-[(4R)-1-[tert-butyl(diphenyl)silyl]oxy-7-oxoundecan-4-yl]-5-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 134852995) has the molecular formula C39H59NO7Si and a molecular weight of 681.99 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,5S)-2-[(4R)-1-[tert-butyl(diphenyl)silyl]oxy-7-oxoundecan-4-yl]-5-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,5S)-2-[(4R)-1-[tert-butyl(diphenyl)silyl]oxy-7-oxoundecan-4-yl]-5-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134852995 |
| Molecular Formula | C39H59NO7Si |
| Molecular Weight | 681.99 g/mol |
| Exact Mass | 681.41 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,5S)-2-[(4R)-1-[tert-butyl(diphenyl)silyl]oxy-7-oxoundecan-4-yl]-5-(hydroxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCC(=O)CC[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@]1(C(=O)OC)CC[C@@H](CO)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H59NO7Si/c1-9-10-19-32(42)25-24-30(39(35(43)45-8)27-26-31(29-41)40(39)36(44)47-37(2,3)4)18-17-28-46-48(38(5,6)7,33-20-13-11-14-21-33)34-22-15-12-16-23-34/h11-16,20-23,30-31,41H,9-10,17-19,24-29H2,1-8H3/t30-,31+,39+/m1/s1 |
| InChIKey | ISHHPLJXPKPVLQ-KJIWSKFMSA-N |
| XLogP | 6.80 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.99 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|