C43H68N2O5Si — CID 131720537
tert-butyl (4S,5S)-5-[(2R)-2-(butylcarbamoyl)hex-4-enyl]-4-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 131720537) has the molecular formula C43H68N2O5Si and a molecular weight of 721.11 g/mol. Its IUPAC name is tert-butyl (4S,5S)-5-[(2R)-2-(butylcarbamoyl)hex-4-enyl]-4-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-5-[(2R)-2-(butylcarbamoyl)hex-4-enyl]-4-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 131720537 |
| Molecular Formula | C43H68N2O5Si |
| Molecular Weight | 721.11 g/mol |
| Exact Mass | 720.49 |
| IUPAC Name | tert-butyl (4S,5S)-5-[(2R)-2-(butylcarbamoyl)hex-4-enyl]-4-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC=CC[C@H](C[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CC(C)(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)NCCCC |
| InChI | InChI=1S/C43H68N2O5Si/c1-13-15-23-33(38(46)44-29-16-14-2)31-37-36(45(43(11,12)49-37)39(47)50-40(3,4)5)32-42(9,10)28-30-48-51(41(6,7)8,34-24-19-17-20-25-34)35-26-21-18-22-27-35/h13,15,17-22,24-27,33,36-37H,14,16,23,28-32H2,1-12H3,(H,44,46)/t33-,36+,37+/m1/s1 |
| InChIKey | XQDCGOUPWYJSJA-HTVAGRJCSA-N |
| XLogP | 9.00 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.11 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|