C32H39NO2Si — CID 11813057
(3S,8aR)-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 11813057) has the molecular formula C32H39NO2Si and a molecular weight of 497.76 g/mol. Its IUPAC name is (3S,8aR)-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (3S,8aR)-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 11813057 |
| Molecular Formula | C32H39NO2Si |
| Molecular Weight | 497.76 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | (3S,8aR)-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@H]2CCC(Cc3ccccc3)C(=O)N21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H39NO2Si/c1-32(2,3)36(29-15-9-5-10-16-29,30-17-11-6-12-18-30)35-24-28-22-21-27-20-19-26(31(34)33(27)28)23-25-13-7-4-8-14-25/h4-18,26-28H,19-24H2,1-3H3/t26?,27-,28+/m1/s1 |
| InChIKey | BWGCEMDWZFZLSK-OEBVTXOESA-N |
| XLogP | 5.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.76 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|