C28H37NO2Si — CID 10983185
(1R,3R,5R,8S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-propyl-6-azatricyclo[4.3.0.01,3]nonan-7-one (PubChem CID 10983185) has the molecular formula C28H37NO2Si and a molecular weight of 447.70 g/mol. Its IUPAC name is (1R,3R,5R,8S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-propyl-6-azatricyclo[4.3.0.01,3]nonan-7-one.
| Compound Name | (1R,3R,5R,8S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-propyl-6-azatricyclo[4.3.0.01,3]nonan-7-one |
|---|---|
| PubChem CID | 10983185 |
| Molecular Formula | C28H37NO2Si |
| Molecular Weight | 447.70 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | (1R,3R,5R,8S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-propyl-6-azatricyclo[4.3.0.01,3]nonan-7-one |
| SMILES | CCC[C@H]1C[C@]23C[C@H]2C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N3C1=O |
| InChI | InChI=1S/C28H37NO2Si/c1-5-12-21-18-28-19-22(28)17-23(29(28)26(21)30)20-31-32(27(2,3)4,24-13-8-6-9-14-24)25-15-10-7-11-16-25/h6-11,13-16,21-23H,5,12,17-20H2,1-4H3/t21-,22+,23+,28-/m0/s1 |
| InChIKey | NFQKGHAMYFBYNP-FPZRTEDSSA-N |
| XLogP | 4.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|