C25H33NO2Si — CID 175570904
(2S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 175570904) has the molecular formula C25H33NO2Si and a molecular weight of 407.63 g/mol. Its IUPAC name is (2S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (2S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 175570904 |
| Molecular Formula | C25H33NO2Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (2S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[C@H]1CC2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CCCN2C1=O |
| InChI | InChI=1S/C25H33NO2Si/c1-20-18-25(16-11-17-26(25)23(20)27)19-28-29(24(2,3)4,21-12-7-5-8-13-21)22-14-9-6-10-15-22/h5-10,12-15,20H,11,16-19H2,1-4H3/t20-,25?/m0/s1 |
| InChIKey | PAKRATPILJWTFK-JINQPTGOSA-N |
| XLogP | 3.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|