C24H33NO2Si — CID 157399412
tert-butyl-[[(4R)-3,5-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptan-1-yl]methoxy]-diphenylsilane (PubChem CID 157399412) has the molecular formula C24H33NO2Si and a molecular weight of 395.62 g/mol. Its IUPAC name is tert-butyl-[[(4R)-3,5-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptan-1-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(4R)-3,5-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptan-1-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 157399412 |
| Molecular Formula | C24H33NO2Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | tert-butyl-[[(4R)-3,5-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptan-1-yl]methoxy]-diphenylsilane |
| SMILES | CC1OC2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]1N(C)C2 |
| InChI | InChI=1S/C24H33NO2Si/c1-19-22-16-24(27-19,17-25(22)5)18-26-28(23(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19,22H,16-18H2,1-5H3/t19?,22-,24?/m1/s1 |
| InChIKey | ANLITNAGQWAXSS-HWDGFJGFSA-N |
| XLogP | 3.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|