C28H36FNO3Si — CID 176790512
(2S,6R,8S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2-(prop-2-enoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 176790512) has the molecular formula C28H36FNO3Si and a molecular weight of 481.68 g/mol. Its IUPAC name is (2S,6R,8S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2-(prop-2-enoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (2S,6R,8S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2-(prop-2-enoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 176790512 |
| Molecular Formula | C28H36FNO3Si |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (2S,6R,8S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-fluoro-2-(prop-2-enoxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C=CCOC[C@@H]1C[C@@]2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H](F)CN2C1=O |
| InChI | InChI=1S/C28H36FNO3Si/c1-5-16-32-20-22-17-28(18-23(29)19-30(28)26(22)31)21-33-34(27(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h5-15,22-23H,1,16-21H2,2-4H3/t22-,23+,28-/m0/s1 |
| InChIKey | SIBGZCRIOOZHQC-JWZKTCGFSA-N |
| XLogP | 4.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|