C27H34O4Si — CID 24827824
prop-2-enyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxocyclohexane-1-carboxylate (PubChem CID 24827824) has the molecular formula C27H34O4Si and a molecular weight of 450.65 g/mol. Its IUPAC name is prop-2-enyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxocyclohexane-1-carboxylate.
| Compound Name | prop-2-enyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 24827824 |
| Molecular Formula | C27H34O4Si |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | prop-2-enyl 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxocyclohexane-1-carboxylate |
| SMILES | C=CCOC(=O)C1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCCCC1=O |
| InChI | InChI=1S/C27H34O4Si/c1-5-20-30-25(29)27(19-13-12-18-24(27)28)21-31-32(26(2,3)4,22-14-8-6-9-15-22)23-16-10-7-11-17-23/h5-11,14-17H,1,12-13,18-21H2,2-4H3 |
| InChIKey | RFRTUTCDPSCKDR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|