C26H35NO2Si — CID 57338210
(5S,8R,8aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 57338210) has the molecular formula C26H35NO2Si and a molecular weight of 421.66 g/mol. Its IUPAC name is (5S,8R,8aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (5S,8R,8aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 57338210 |
| Molecular Formula | C26H35NO2Si |
| Molecular Weight | 421.66 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (5S,8R,8aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C26H35NO2Si/c1-20-15-16-21(27-24(20)17-18-25(27)28)19-29-30(26(2,3)4,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-14,20-21,24H,15-19H2,1-4H3/t20-,21+,24+/m1/s1 |
| InChIKey | MXLBTHJARKXPHT-DPLHUUCSSA-N |
| XLogP | 4.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|