C31H43NO5Si — CID 11591931
dimethyl (2R,3S,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenyl-5-propylpiperidine-1,2-dicarboxylate (PubChem CID 11591931) has the molecular formula C31H43NO5Si and a molecular weight of 537.77 g/mol. Its IUPAC name is dimethyl (2R,3S,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenyl-5-propylpiperidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2R,3S,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenyl-5-propylpiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11591931 |
| Molecular Formula | C31H43NO5Si |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | dimethyl (2R,3S,5R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethenyl-5-propylpiperidine-1,2-dicarboxylate |
| SMILES | C=C[C@@H]1C[C@@H](CCC)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C31H43NO5Si/c1-8-16-24-21-23(9-2)28(29(33)35-6)32(30(34)36-7)27(24)22-37-38(31(3,4)5,25-17-12-10-13-18-25)26-19-14-11-15-20-26/h9-15,17-20,23-24,27-28H,2,8,16,21-22H2,1,3-7H3/t23-,24-,27-,28-/m1/s1 |
| InChIKey | ZNHULOMJWXBJKA-NFFAYCCRSA-N |
| XLogP | 5.16 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|