C41H57NO5Si — CID 11858575
[(3S,5R)-9-[tert-butyl(diphenyl)silyl]oxy-3-methylnon-1-en-5-yl] (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate (PubChem CID 11858575) has the molecular formula C41H57NO5Si and a molecular weight of 672.00 g/mol. Its IUPAC name is [(3S,5R)-9-[tert-butyl(diphenyl)silyl]oxy-3-methylnon-1-en-5-yl] (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate.
| Compound Name | [(3S,5R)-9-[tert-butyl(diphenyl)silyl]oxy-3-methylnon-1-en-5-yl] (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11858575 |
| Molecular Formula | C41H57NO5Si |
| Molecular Weight | 672.00 g/mol |
| Exact Mass | 671.40 |
| IUPAC Name | [(3S,5R)-9-[tert-butyl(diphenyl)silyl]oxy-3-methylnon-1-en-5-yl] (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate |
| SMILES | C=C[C@@H](C)C[C@@H](CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)[C@H](Cc1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H57NO5Si/c1-10-32(2)30-34(46-38(43)37(31-33-22-14-11-15-23-33)42(9)39(44)47-40(3,4)5)24-20-21-29-45-48(41(6,7)8,35-25-16-12-17-26-35)36-27-18-13-19-28-36/h10-19,22-23,25-28,32,34,37H,1,20-21,24,29-31H2,2-9H3/t32-,34-,37+/m1/s1 |
| InChIKey | KWUAPAHIKCWXOM-ZGGPYXEISA-N |
| XLogP | 8.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.00 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|