C34H47NO5Si — CID 11585040
methyl (2S,3R,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-propylpiperidine-1-carboxylate (PubChem CID 11585040) has the molecular formula C34H47NO5Si and a molecular weight of 577.84 g/mol. Its IUPAC name is methyl (2S,3R,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-propylpiperidine-1-carboxylate.
| Compound Name | methyl (2S,3R,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-propylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11585040 |
| Molecular Formula | C34H47NO5Si |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | methyl (2S,3R,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-propylpiperidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@@H](CCC)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC)[C@H]1/C=C/C(=O)OCC |
| InChI | InChI=1S/C34H47NO5Si/c1-8-17-27-24-26(9-2)30(22-23-32(36)39-10-3)35(33(37)38-7)31(27)25-40-41(34(4,5)6,28-18-13-11-14-19-28)29-20-15-12-16-21-29/h9,11-16,18-23,26-27,30-31H,2,8,10,17,24-25H2,1,3-7H3/b23-22+/t26-,27-,30+,31-/m1/s1 |
| InChIKey | YCHJIYOLJILOQZ-UHNRLLPFSA-N |
| XLogP | 6.11 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|