C37H50F3NO4Si — CID 101346089
ethyl (E)-4-[(4R,5R,7R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-(2,2,2-trifluoroacetyl)-6-azaspiro[4.5]decan-7-yl]-2-methylbut-2-enoate (PubChem CID 101346089) has the molecular formula C37H50F3NO4Si and a molecular weight of 657.89 g/mol. Its IUPAC name is ethyl (E)-4-[(4R,5R,7R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-(2,2,2-trifluoroacetyl)-6-azaspiro[4.5]decan-7-yl]-2-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[(4R,5R,7R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-(2,2,2-trifluoroacetyl)-6-azaspiro[4.5]decan-7-yl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 101346089 |
| Molecular Formula | C37H50F3NO4Si |
| Molecular Weight | 657.89 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | ethyl (E)-4-[(4R,5R,7R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-(2,2,2-trifluoroacetyl)-6-azaspiro[4.5]decan-7-yl]-2-methylbut-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C[C@H]1CCC[C@@]2(CCC[C@@H]2[C@@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C37H50F3NO4Si/c1-7-44-33(42)27(2)22-23-29-16-14-24-36(41(29)34(43)37(38,39)40)25-15-21-32(36)28(3)26-45-46(35(4,5)6,30-17-10-8-11-18-30)31-19-12-9-13-20-31/h8-13,17-20,22,28-29,32H,7,14-16,21,23-26H2,1-6H3/b27-22+/t28-,29+,32+,36-/m0/s1 |
| InChIKey | DTHVQZVNGCIACT-QSUIJLGZSA-N |
| XLogP | 7.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.89 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|