C37H53NO3Si — CID 11753583
ethyl 2-[[(4R,5S,7R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decan-6-yl]methyl]prop-2-enoate (PubChem CID 11753583) has the molecular formula C37H53NO3Si and a molecular weight of 587.92 g/mol. Its IUPAC name is ethyl 2-[[(4R,5S,7R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decan-6-yl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[(4R,5S,7R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decan-6-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 11753583 |
| Molecular Formula | C37H53NO3Si |
| Molecular Weight | 587.92 g/mol |
| Exact Mass | 587.38 |
| IUPAC Name | ethyl 2-[[(4R,5S,7R)-4-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decan-6-yl]methyl]prop-2-enoate |
| SMILES | C=CC[C@H]1CCC[C@]2(CCC[C@@H]2[C@@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1CC(=C)C(=O)OCC |
| InChI | InChI=1S/C37H53NO3Si/c1-8-18-31-19-16-25-37(38(31)27-29(3)35(39)40-9-2)26-17-24-34(37)30(4)28-41-42(36(5,6)7,32-20-12-10-13-21-32)33-22-14-11-15-23-33/h8,10-15,20-23,30-31,34H,1,3,9,16-19,24-28H2,2,4-7H3/t30-,31-,34+,37+/m0/s1 |
| InChIKey | CPIPVJIGOKMZQK-RLJOAXSFSA-N |
| XLogP | 7.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.92 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|