C37H53NO5Si — CID 42631458
diethyl 2-[2-[(4S,5R,7S)-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-azaspiro[4.5]decan-7-yl]ethylidene]propanedioate (PubChem CID 42631458) has the molecular formula C37H53NO5Si and a molecular weight of 619.92 g/mol. Its IUPAC name is diethyl 2-[2-[(4S,5R,7S)-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-azaspiro[4.5]decan-7-yl]ethylidene]propanedioate.
| Compound Name | diethyl 2-[2-[(4S,5R,7S)-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-azaspiro[4.5]decan-7-yl]ethylidene]propanedioate |
|---|---|
| PubChem CID | 42631458 |
| Molecular Formula | C37H53NO5Si |
| Molecular Weight | 619.92 g/mol |
| Exact Mass | 619.37 |
| IUPAC Name | diethyl 2-[2-[(4S,5R,7S)-4-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-6-azaspiro[4.5]decan-7-yl]ethylidene]propanedioate |
| SMILES | CCOC(=O)C(=CC[C@@H]1CCC[C@@]2(CCC[C@H]2[C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1)C(=O)OCC |
| InChI | InChI=1S/C37H53NO5Si/c1-7-41-34(39)32(35(40)42-8-2)24-23-29-17-15-25-37(38-29)26-16-22-33(37)28(3)27-43-44(36(4,5)6,30-18-11-9-12-19-30)31-20-13-10-14-21-31/h9-14,18-21,24,28-29,33,38H,7-8,15-17,22-23,25-27H2,1-6H3/t28-,29+,33+,37+/m1/s1 |
| InChIKey | PSWVJIRPBUTTJV-GRGIOORFSA-N |
| XLogP | 6.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.92 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|