C40H59NO5Si — CID 11527565
ethyl (2E,4E)-8-[(1R,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]-2-methylocta-2,4-dienoate (PubChem CID 11527565) has the molecular formula C40H59NO5Si and a molecular weight of 662.00 g/mol. Its IUPAC name is ethyl (2E,4E)-8-[(1R,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]-2-methylocta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-8-[(1R,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]-2-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 11527565 |
| Molecular Formula | C40H59NO5Si |
| Molecular Weight | 662.00 g/mol |
| Exact Mass | 661.42 |
| IUPAC Name | ethyl (2E,4E)-8-[(1R,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]-2-methylocta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/CCC[C@@]1(NC(=O)OC(C)(C)C)CCC[C@@H]1[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H59NO5Si/c1-10-44-36(42)31(2)22-15-11-12-20-28-40(41-37(43)46-38(4,5)6)29-21-27-35(40)32(3)30-45-47(39(7,8)9,33-23-16-13-17-24-33)34-25-18-14-19-26-34/h11,13-19,22-26,32,35H,10,12,20-21,27-30H2,1-9H3,(H,41,43)/b15-11+,31-22+/t32-,35+,40+/m0/s1 |
| InChIKey | OQXHPFBBTLCXBV-RQZPZSRZSA-N |
| XLogP | 8.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.00 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|