C31H45NO3Si — CID 11103186
methyl (Z)-6-[(1S,2R)-1-amino-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]cyclopentyl]hex-2-enoate (PubChem CID 11103186) has the molecular formula C31H45NO3Si and a molecular weight of 507.79 g/mol. Its IUPAC name is methyl (Z)-6-[(1S,2R)-1-amino-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]cyclopentyl]hex-2-enoate.
| Compound Name | methyl (Z)-6-[(1S,2R)-1-amino-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]cyclopentyl]hex-2-enoate |
|---|---|
| PubChem CID | 11103186 |
| Molecular Formula | C31H45NO3Si |
| Molecular Weight | 507.79 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | methyl (Z)-6-[(1S,2R)-1-amino-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]cyclopentyl]hex-2-enoate |
| SMILES | COC(=O)/C=C\CCC[C@@]1(N)CCC[C@@H]1[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H45NO3Si/c1-25(28-20-15-23-31(28,32)22-14-8-13-21-29(33)34-5)24-35-36(30(2,3)4,26-16-9-6-10-17-26)27-18-11-7-12-19-27/h6-7,9-13,16-19,21,25,28H,8,14-15,20,22-24,32H2,1-5H3/b21-13-/t25-,28+,31+/m0/s1 |
| InChIKey | AXSBYWUOGZIDLA-ZDFXEFIASA-N |
| XLogP | 5.60 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.79 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|