C31H44O3Si — CID 90924714
methyl (4S)-4-[(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]pent-2-enoate (PubChem CID 90924714) has the molecular formula C31H44O3Si and a molecular weight of 492.78 g/mol. Its IUPAC name is methyl (4S)-4-[(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]pent-2-enoate.
| Compound Name | methyl (4S)-4-[(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]pent-2-enoate |
|---|---|
| PubChem CID | 90924714 |
| Molecular Formula | C31H44O3Si |
| Molecular Weight | 492.78 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | methyl (4S)-4-[(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]pent-2-enoate |
| SMILES | COC(=O)C=C[C@H](C)[C@@]1(C)CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C31H44O3Si/c1-24(19-20-28(32)33-8)31(7)22-21-25(30(31,5)6)23-34-35(29(2,3)4,26-15-11-9-12-16-26)27-17-13-10-14-18-27/h9-20,24-25H,21-23H2,1-8H3/t24-,25-,31+/m0/s1 |
| InChIKey | SPBRENJYDKYQQS-AKOVUPKNSA-N |
| XLogP | 6.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.78 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|