C27H36O3Si — CID 11453388
ethyl (E,4S)-4-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]pent-2-enoate (PubChem CID 11453388) has the molecular formula C27H36O3Si and a molecular weight of 436.67 g/mol. Its IUPAC name is ethyl (E,4S)-4-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]pent-2-enoate |
|---|---|
| PubChem CID | 11453388 |
| Molecular Formula | C27H36O3Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | ethyl (E,4S)-4-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@H]1C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H36O3Si/c1-6-29-26(28)18-17-21(2)25-19-22(25)20-30-31(27(3,4)5,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-18,21-22,25H,6,19-20H2,1-5H3/b18-17+/t21-,22-,25+/m0/s1 |
| InChIKey | IVLZAQOEHNMWGD-UKMBGMJCSA-N |
| XLogP | 4.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|