C30H42O3Si — CID 140750435
ethyl (Z)-3-[2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopentyl]prop-2-enoate (PubChem CID 140750435) has the molecular formula C30H42O3Si and a molecular weight of 478.75 g/mol. Its IUPAC name is ethyl (Z)-3-[2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopentyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopentyl]prop-2-enoate |
|---|---|
| PubChem CID | 140750435 |
| Molecular Formula | C30H42O3Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | ethyl (Z)-3-[2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopentyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\C1CCCC1[C@@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H42O3Si/c1-6-32-29(31)21-20-25-14-13-19-28(25)24(2)22-23-33-34(30(3,4)5,26-15-9-7-10-16-26)27-17-11-8-12-18-27/h7-12,15-18,20-21,24-25,28H,6,13-14,19,22-23H2,1-5H3/b21-20-/t24-,25?,28?/m0/s1 |
| InChIKey | ZJZUXFVLXQSLNQ-QBDLFXFBSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|