C35H51NO4Si — CID 11577816
tert-butyl N-[(1S,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(E)-6-oxohex-4-enyl]cyclopentyl]carbamate (PubChem CID 11577816) has the molecular formula C35H51NO4Si and a molecular weight of 577.88 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(E)-6-oxohex-4-enyl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(E)-6-oxohex-4-enyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 11577816 |
| Molecular Formula | C35H51NO4Si |
| Molecular Weight | 577.88 g/mol |
| Exact Mass | 577.36 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(E)-6-oxohex-4-enyl]cyclopentyl]carbamate |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CCC[C@@]1(CCC/C=C/C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H51NO4Si/c1-28(27-39-41(34(5,6)7,29-19-12-10-13-20-29)30-21-14-11-15-22-30)31-23-18-25-35(31,24-16-8-9-17-26-37)36-32(38)40-33(2,3)4/h9-15,17,19-22,26,28,31H,8,16,18,23-25,27H2,1-7H3,(H,36,38)/b17-9+/t28-,31+,35+/m0/s1 |
| InChIKey | LCTIIOZSOWIZPQ-NNMQNHQASA-N |
| XLogP | 7.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.88 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|