C34H51NO3Si — CID 11671194
tert-butyl N-[(1R,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-pent-4-enylcyclopentyl]carbamate (PubChem CID 11671194) has the molecular formula C34H51NO3Si and a molecular weight of 549.87 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-pent-4-enylcyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-pent-4-enylcyclopentyl]carbamate |
|---|---|
| PubChem CID | 11671194 |
| Molecular Formula | C34H51NO3Si |
| Molecular Weight | 549.87 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-pent-4-enylcyclopentyl]carbamate |
| SMILES | C=CCCC[C@@]1(NC(=O)OC(C)(C)C)CCC[C@@H]1[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H51NO3Si/c1-9-10-17-24-34(35-31(36)38-32(3,4)5)25-18-23-30(34)27(2)26-37-39(33(6,7)8,28-19-13-11-14-20-28)29-21-15-12-16-22-29/h9,11-16,19-22,27,30H,1,10,17-18,23-26H2,2-8H3,(H,35,36)/t27-,30+,34+/m0/s1 |
| InChIKey | FWYKYDOEFKUKKE-PEMZAYNASA-N |
| XLogP | 7.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.87 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|