C16H29NO3 — CID 10956996
tert-butyl N-[(1S,2R)-2-[(2R)-1-hydroxypropan-2-yl]-1-prop-2-enylcyclopentyl]carbamate (PubChem CID 10956996) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-[(2R)-1-hydroxypropan-2-yl]-1-prop-2-enylcyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-[(2R)-1-hydroxypropan-2-yl]-1-prop-2-enylcyclopentyl]carbamate |
|---|---|
| PubChem CID | 10956996 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-[(2R)-1-hydroxypropan-2-yl]-1-prop-2-enylcyclopentyl]carbamate |
| SMILES | C=CC[C@@]1(NC(=O)OC(C)(C)C)CCC[C@@H]1[C@@H](C)CO |
| InChI | InChI=1S/C16H29NO3/c1-6-9-16(17-14(19)20-15(3,4)5)10-7-8-13(16)12(2)11-18/h6,12-13,18H,1,7-11H2,2-5H3,(H,17,19)/t12-,13+,16+/m0/s1 |
| InChIKey | HILOTQZPIIPLGW-WOSRLPQWSA-N |
| XLogP | 3.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|