C20H32N2O6 — CID 69042452
2,4-dimethylpentan-2-yl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5-dioxo-4-prop-2-enylpyrrolidine-2-carboxylate (PubChem CID 69042452) has the molecular formula C20H32N2O6 and a molecular weight of 396.48 g/mol. Its IUPAC name is 2,4-dimethylpentan-2-yl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5-dioxo-4-prop-2-enylpyrrolidine-2-carboxylate.
| Compound Name | 2,4-dimethylpentan-2-yl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5-dioxo-4-prop-2-enylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 69042452 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2,4-dimethylpentan-2-yl (2R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5-dioxo-4-prop-2-enylpyrrolidine-2-carboxylate |
| SMILES | C=CC[C@@]1(NC(=O)OC(C)(C)C)C(=O)N[C@@H](C(=O)OC(C)(C)CC(C)C)C1=O |
| InChI | InChI=1S/C20H32N2O6/c1-9-10-20(22-17(26)28-18(4,5)6)14(23)13(21-16(20)25)15(24)27-19(7,8)11-12(2)3/h9,12-13H,1,10-11H2,2-8H3,(H,21,25)(H,22,26)/t13-,20+/m1/s1 |
| InChIKey | NSSCAADMDDXPJN-XCLFUZPHSA-N |
| XLogP | 2.26 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|