C22H36N2O6 — CID 102027122
tert-butyl (5R)-3-(3-methylbut-2-enyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,4-dioxo-5-propan-2-ylpyrrolidine-1-carboxylate (PubChem CID 102027122) has the molecular formula C22H36N2O6 and a molecular weight of 424.54 g/mol. Its IUPAC name is tert-butyl (5R)-3-(3-methylbut-2-enyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,4-dioxo-5-propan-2-ylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5R)-3-(3-methylbut-2-enyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,4-dioxo-5-propan-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102027122 |
| Molecular Formula | C22H36N2O6 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | tert-butyl (5R)-3-(3-methylbut-2-enyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,4-dioxo-5-propan-2-ylpyrrolidine-1-carboxylate |
| SMILES | CC(C)=CCC1(NC(=O)OC(C)(C)C)C(=O)[C@@H](C(C)C)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C22H36N2O6/c1-13(2)11-12-22(23-18(27)29-20(5,6)7)16(25)15(14(3)4)24(17(22)26)19(28)30-21(8,9)10/h11,14-15H,12H2,1-10H3,(H,23,27)/t15-,22?/m1/s1 |
| InChIKey | RTPPIQJKSGOJLH-JGHKVMFLSA-N |
| XLogP | 3.98 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|