C13H21NO4 — CID 134242401
tert-butyl (3R,5S)-5-(2-methylpropyl)-4-oxo-1-oxa-6-azaspiro[2.3]hexane-6-carboxylate (PubChem CID 134242401) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is tert-butyl (3R,5S)-5-(2-methylpropyl)-4-oxo-1-oxa-6-azaspiro[2.3]hexane-6-carboxylate.
| Compound Name | tert-butyl (3R,5S)-5-(2-methylpropyl)-4-oxo-1-oxa-6-azaspiro[2.3]hexane-6-carboxylate |
|---|---|
| PubChem CID | 134242401 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | tert-butyl (3R,5S)-5-(2-methylpropyl)-4-oxo-1-oxa-6-azaspiro[2.3]hexane-6-carboxylate |
| SMILES | CC(C)C[C@H]1C(=O)[C@]2(CO2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO4/c1-8(2)6-9-10(15)13(7-17-13)14(9)11(16)18-12(3,4)5/h8-9H,6-7H2,1-5H3/t9-,13+/m0/s1 |
| InChIKey | WURMXMSGWOUKDT-TVQRCGJNSA-N |
| XLogP | 1.95 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|